C15H22N2O2 — CID 71062870
[(2S)-4-[2-(2,3-dihydroindol-1-yl)ethyl]morpholin-2-yl]methanol (PubChem CID 71062870) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is [(2S)-4-[2-(2,3-dihydroindol-1-yl)ethyl]morpholin-2-yl]methanol.
| Compound Name | [(2S)-4-[2-(2,3-dihydroindol-1-yl)ethyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 71062870 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | [(2S)-4-[2-(2,3-dihydroindol-1-yl)ethyl]morpholin-2-yl]methanol |
| SMILES | OC[C@@H]1CN(CCN2CCc3ccccc32)CCO1 |
| InChI | InChI=1S/C15H22N2O2/c18-12-14-11-16(9-10-19-14)7-8-17-6-5-13-3-1-2-4-15(13)17/h1-4,14,18H,5-12H2/t14-/m0/s1 |
| InChIKey | JWGPTFONMSKYKL-AWEZNQCLSA-N |
| XLogP | 0.74 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |