C14H19FN2O3 — CID 71063832
2-methylbutan-2-yl N-[(2-carbamoyl-4-fluorophenyl)methyl]carbamate (PubChem CID 71063832) has the molecular formula C14H19FN2O3 and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-methylbutan-2-yl N-[(2-carbamoyl-4-fluorophenyl)methyl]carbamate.
| Compound Name | 2-methylbutan-2-yl N-[(2-carbamoyl-4-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 71063832 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-methylbutan-2-yl N-[(2-carbamoyl-4-fluorophenyl)methyl]carbamate |
| SMILES | CCC(C)(C)OC(=O)NCc1ccc(F)cc1C(N)=O |
| InChI | InChI=1S/C14H19FN2O3/c1-4-14(2,3)20-13(19)17-8-9-5-6-10(15)7-11(9)12(16)18/h5-7H,4,8H2,1-3H3,(H2,16,18)(H,17,19) |
| InChIKey | ZCTHJXAGJUVZIV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |