C14H24NO3+ — CID 7106458
4-[[(2S,4S)-2-[(1S)-cyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]morpholin-4-ium (PubChem CID 7106458) has the molecular formula C14H24NO3+ and a molecular weight of 254.35 g/mol. Its IUPAC name is 4-[[(2S,4S)-2-[(1S)-cyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]morpholin-4-ium.
| Compound Name | 4-[[(2S,4S)-2-[(1S)-cyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7106458 |
| Molecular Formula | C14H24NO3+ |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 4-[[(2S,4S)-2-[(1S)-cyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]morpholin-4-ium |
| SMILES | C1=CC[C@@H]([C@H]2OC[C@H](C[NH+]3CCOCC3)O2)CC1 |
| InChI | InChI=1S/C14H23NO3/c1-2-4-12(5-3-1)14-17-11-13(18-14)10-15-6-8-16-9-7-15/h1-2,12-14H,3-11H2/p+1/t12-,13+,14+/m1/s1 |
| InChIKey | AAPOJYKIJJMKDM-RDBSUJKOSA-O |
| XLogP | -0.00 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|