C26H35NO4 — CID 71067374
2-[2-(6-cyanonaphthalen-2-yl)oxyethoxy]ethyl 2-tert-butyl-2,3,3-trimethylbutanoate (PubChem CID 71067374) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is 2-[2-(6-cyanonaphthalen-2-yl)oxyethoxy]ethyl 2-tert-butyl-2,3,3-trimethylbutanoate.
| Compound Name | 2-[2-(6-cyanonaphthalen-2-yl)oxyethoxy]ethyl 2-tert-butyl-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 71067374 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 2-[2-(6-cyanonaphthalen-2-yl)oxyethoxy]ethyl 2-tert-butyl-2,3,3-trimethylbutanoate |
| SMILES | CC(C)(C)C(C)(C(=O)OCCOCCOc1ccc2cc(C#N)ccc2c1)C(C)(C)C |
| InChI | InChI=1S/C26H35NO4/c1-24(2,3)26(7,25(4,5)6)23(28)31-15-13-29-12-14-30-22-11-10-20-16-19(18-27)8-9-21(20)17-22/h8-11,16-17H,12-15H2,1-7H3 |
| InChIKey | PEJUSKBHSVHUOR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|