C26H46N2O4 — CID 71068884
(2S,4S,5S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(4-methoxybutyl)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide (PubChem CID 71068884) has the molecular formula C26H46N2O4 and a molecular weight of 450.66 g/mol. Its IUPAC name is (2S,4S,5S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(4-methoxybutyl)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide.
| Compound Name | (2S,4S,5S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(4-methoxybutyl)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 71068884 |
| Molecular Formula | C26H46N2O4 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | (2S,4S,5S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(4-methoxybutyl)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
| SMILES | COCCCCc1cc(CC(C[C@H](N)[C@@H](O)C[C@H](C(N)=O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C26H46N2O4/c1-17(2)21(15-23(27)24(29)16-22(18(3)4)26(28)30)14-19-10-11-25(32-6)20(13-19)9-7-8-12-31-5/h10-11,13,17-18,21-24,29H,7-9,12,14-16,27H2,1-6H3,(H2,28,30)/t21?,22-,23-,24-/m0/s1 |
| InChIKey | JOXCLXJQEBYGPO-NSBVFQKPSA-N |
| XLogP | 3.70 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|