C24H24N2O2 — CID 7107170
N-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-2-oxo-2-(2-phenyl-1H-indol-3-yl)acetamide (PubChem CID 7107170) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-2-oxo-2-(2-phenyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-2-oxo-2-(2-phenyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 7107170 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-2-oxo-2-(2-phenyl-1H-indol-3-yl)acetamide |
| SMILES | O=C(NC[C@@H]1C[C@H]2CC[C@H]1C2)C(=O)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H24N2O2/c27-23(24(28)25-14-18-13-15-10-11-17(18)12-15)21-19-8-4-5-9-20(19)26-22(21)16-6-2-1-3-7-16/h1-9,15,17-18,26H,10-14H2,(H,25,28)/t15-,17-,18-/m0/s1 |
| InChIKey | OATWVEOEZQIVDY-SZMVWBNQSA-N |
| XLogP | 4.57 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|