C23H25BrCl2N2O — CID 71076414
1-[5-(4-bromophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]heptan-1-ol (PubChem CID 71076414) has the molecular formula C23H25BrCl2N2O and a molecular weight of 496.28 g/mol. Its IUPAC name is 1-[5-(4-bromophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]heptan-1-ol.
| Compound Name | 1-[5-(4-bromophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]heptan-1-ol |
|---|---|
| PubChem CID | 71076414 |
| Molecular Formula | C23H25BrCl2N2O |
| Molecular Weight | 496.28 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 1-[5-(4-bromophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]heptan-1-ol |
| SMILES | CCCCCCC(O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C23H25BrCl2N2O/c1-3-4-5-6-7-21(29)22-15(2)23(16-8-10-17(24)11-9-16)28(27-22)20-13-12-18(25)14-19(20)26/h8-14,21,29H,3-7H2,1-2H3 |
| InChIKey | SZSJZDAANIKWPT-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.28 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|