C26H29Cl3IN3O — CID 50907204
2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-2-iodo-N-octylacetamide (PubChem CID 50907204) has the molecular formula C26H29Cl3IN3O and a molecular weight of 632.80 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-2-iodo-N-octylacetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-2-iodo-N-octylacetamide |
|---|---|
| PubChem CID | 50907204 |
| Molecular Formula | C26H29Cl3IN3O |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 631.04 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-2-iodo-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)C(I)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C26H29Cl3IN3O/c1-3-4-5-6-7-8-15-31-26(34)23(30)24-17(2)25(18-9-11-19(27)12-10-18)33(32-24)22-14-13-20(28)16-21(22)29/h9-14,16,23H,3-8,15H2,1-2H3,(H,31,34) |
| InChIKey | CMNRERAWPNIRSB-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|