C18H19ClN2O6 — CID 71077222
methyl 6-chloro-8-[[(3-ethoxy-3-oxopropanoyl)amino]methyl]-2-methoxyquinoline-3-carboxylate (PubChem CID 71077222) has the molecular formula C18H19ClN2O6 and a molecular weight of 394.81 g/mol. Its IUPAC name is methyl 6-chloro-8-[[(3-ethoxy-3-oxopropanoyl)amino]methyl]-2-methoxyquinoline-3-carboxylate.
| Compound Name | methyl 6-chloro-8-[[(3-ethoxy-3-oxopropanoyl)amino]methyl]-2-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 71077222 |
| Molecular Formula | C18H19ClN2O6 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | methyl 6-chloro-8-[[(3-ethoxy-3-oxopropanoyl)amino]methyl]-2-methoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)CC(=O)NCc1cc(Cl)cc2cc(C(=O)OC)c(OC)nc12 |
| InChI | InChI=1S/C18H19ClN2O6/c1-4-27-15(23)8-14(22)20-9-11-6-12(19)5-10-7-13(18(24)26-3)17(25-2)21-16(10)11/h5-7H,4,8-9H2,1-3H3,(H,20,22) |
| InChIKey | LJSLZNABQRSOSN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|