C19H17ClN4O4 — CID 71077473
methyl 6-chloro-2-methoxy-8-[(pyridin-3-ylcarbamoylamino)methyl]quinoline-3-carboxylate (PubChem CID 71077473) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is methyl 6-chloro-2-methoxy-8-[(pyridin-3-ylcarbamoylamino)methyl]quinoline-3-carboxylate.
| Compound Name | methyl 6-chloro-2-methoxy-8-[(pyridin-3-ylcarbamoylamino)methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 71077473 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | methyl 6-chloro-2-methoxy-8-[(pyridin-3-ylcarbamoylamino)methyl]quinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(Cl)cc(CNC(=O)Nc3cccnc3)c2nc1OC |
| InChI | InChI=1S/C19H17ClN4O4/c1-27-17-15(18(25)28-2)8-11-6-13(20)7-12(16(11)24-17)9-22-19(26)23-14-4-3-5-21-10-14/h3-8,10H,9H2,1-2H3,(H2,22,23,26) |
| InChIKey | MRYCZGJMWHGHMI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |