C17H13ClN4O4 — CID 71077330
6-chloro-2-oxo-8-[(pyridin-3-ylcarbamoylamino)methyl]-1H-quinoline-3-carboxylic acid (PubChem CID 71077330) has the molecular formula C17H13ClN4O4 and a molecular weight of 372.77 g/mol. Its IUPAC name is 6-chloro-2-oxo-8-[(pyridin-3-ylcarbamoylamino)methyl]-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-chloro-2-oxo-8-[(pyridin-3-ylcarbamoylamino)methyl]-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71077330 |
| Molecular Formula | C17H13ClN4O4 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 6-chloro-2-oxo-8-[(pyridin-3-ylcarbamoylamino)methyl]-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(NCc1cc(Cl)cc2cc(C(=O)O)c(=O)[nH]c12)Nc1cccnc1 |
| InChI | InChI=1S/C17H13ClN4O4/c18-11-4-9-6-13(16(24)25)15(23)22-14(9)10(5-11)7-20-17(26)21-12-2-1-3-19-8-12/h1-6,8H,7H2,(H,22,23)(H,24,25)(H2,20,21,26) |
| InChIKey | GJKPXCTVLUZBPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |