C19H12ClF3N2O4 — CID 71077641
6-chloro-2-oxo-8-[[[2-(2,4,5-trifluorophenyl)acetyl]amino]methyl]-1H-quinoline-3-carboxylic acid (PubChem CID 71077641) has the molecular formula C19H12ClF3N2O4 and a molecular weight of 424.76 g/mol. Its IUPAC name is 6-chloro-2-oxo-8-[[[2-(2,4,5-trifluorophenyl)acetyl]amino]methyl]-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-chloro-2-oxo-8-[[[2-(2,4,5-trifluorophenyl)acetyl]amino]methyl]-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71077641 |
| Molecular Formula | C19H12ClF3N2O4 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 6-chloro-2-oxo-8-[[[2-(2,4,5-trifluorophenyl)acetyl]amino]methyl]-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(Cc1cc(F)c(F)cc1F)NCc1cc(Cl)cc2cc(C(=O)O)c(=O)[nH]c12 |
| InChI | InChI=1S/C19H12ClF3N2O4/c20-11-1-9-3-12(19(28)29)18(27)25-17(9)10(2-11)7-24-16(26)5-8-4-14(22)15(23)6-13(8)21/h1-4,6H,5,7H2,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | GGSUMAKRDUUYEM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|