C21H14ClN3O4 — CID 71077399
6-chloro-2-oxo-8-[(quinoline-3-carbonylamino)methyl]-1H-quinoline-3-carboxylic acid (PubChem CID 71077399) has the molecular formula C21H14ClN3O4 and a molecular weight of 407.81 g/mol. Its IUPAC name is 6-chloro-2-oxo-8-[(quinoline-3-carbonylamino)methyl]-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-chloro-2-oxo-8-[(quinoline-3-carbonylamino)methyl]-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71077399 |
| Molecular Formula | C21H14ClN3O4 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 6-chloro-2-oxo-8-[(quinoline-3-carbonylamino)methyl]-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(NCc1cc(Cl)cc2cc(C(=O)O)c(=O)[nH]c12)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C21H14ClN3O4/c22-15-6-12-8-16(21(28)29)20(27)25-18(12)13(7-15)9-24-19(26)14-5-11-3-1-2-4-17(11)23-10-14/h1-8,10H,9H2,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | AWIGAHVJFIJARR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |