C20H16Cl2N2O4 — CID 71077746
methyl 6-chloro-8-[[(3-chlorobenzoyl)amino]methyl]-2-methoxyquinoline-3-carboxylate (PubChem CID 71077746) has the molecular formula C20H16Cl2N2O4 and a molecular weight of 419.26 g/mol. Its IUPAC name is methyl 6-chloro-8-[[(3-chlorobenzoyl)amino]methyl]-2-methoxyquinoline-3-carboxylate.
| Compound Name | methyl 6-chloro-8-[[(3-chlorobenzoyl)amino]methyl]-2-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 71077746 |
| Molecular Formula | C20H16Cl2N2O4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | methyl 6-chloro-8-[[(3-chlorobenzoyl)amino]methyl]-2-methoxyquinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(Cl)cc(CNC(=O)c3cccc(Cl)c3)c2nc1OC |
| InChI | InChI=1S/C20H16Cl2N2O4/c1-27-19-16(20(26)28-2)9-12-7-15(22)8-13(17(12)24-19)10-23-18(25)11-4-3-5-14(21)6-11/h3-9H,10H2,1-2H3,(H,23,25) |
| InChIKey | GSHUIBAFDZINIU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |