C22H21ClN2O4 — CID 71077365
methyl 6-chloro-2-methoxy-8-[(2-phenylpropanoylamino)methyl]quinoline-3-carboxylate (PubChem CID 71077365) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is methyl 6-chloro-2-methoxy-8-[(2-phenylpropanoylamino)methyl]quinoline-3-carboxylate.
| Compound Name | methyl 6-chloro-2-methoxy-8-[(2-phenylpropanoylamino)methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 71077365 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | methyl 6-chloro-2-methoxy-8-[(2-phenylpropanoylamino)methyl]quinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(Cl)cc(CNC(=O)C(C)c3ccccc3)c2nc1OC |
| InChI | InChI=1S/C22H21ClN2O4/c1-13(14-7-5-4-6-8-14)20(26)24-12-16-10-17(23)9-15-11-18(22(27)29-3)21(28-2)25-19(15)16/h4-11,13H,12H2,1-3H3,(H,24,26) |
| InChIKey | ZPGYPYKWXUJDKG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |