C27H31FN4O8 — CID 71080384
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[(3S)-3-(methylamino)-2-oxopiperidin-1-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 71080384) has the molecular formula C27H31FN4O8 and a molecular weight of 558.56 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[(3S)-3-(methylamino)-2-oxopiperidin-1-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[(3S)-3-(methylamino)-2-oxopiperidin-1-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 71080384 |
| Molecular Formula | C27H31FN4O8 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[(3S)-3-(methylamino)-2-oxopiperidin-1-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN[C@H]1CCCN(c2cc(F)c3c(c2O)C(O)=C2C(=O)[C@]4(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]4C[C@@H]2C3)C1=O |
| InChI | InChI=1S/C27H31FN4O8/c1-30-14-5-4-6-32(26(14)39)15-9-13(28)11-7-10-8-12-19(31(2)3)22(35)18(25(29)38)24(37)27(12,40)23(36)16(10)21(34)17(11)20(15)33/h9-10,12,14,19,30,33-34,37,40H,4-8H2,1-3H3,(H2,29,38)/t10-,12-,14-,19-,27-/m0/s1 |
| InChIKey | IAFFDPBFDKUBQB-OAHAOFKGSA-N |
| XLogP | -0.18 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|