C28H33FN4O7 — CID 121288140
(6aR,7aS,8S,11aR)-8-(dimethylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-9,12-dioxo-4-pyrrolidin-1-yl-2,3,4,6,6a,7,7a,8-octahydro-1H-anthra[2,3-g]quinoline-10-carboxamide (PubChem CID 121288140) has the molecular formula C28H33FN4O7 and a molecular weight of 556.59 g/mol. Its IUPAC name is (6aR,7aS,8S,11aR)-8-(dimethylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-9,12-dioxo-4-pyrrolidin-1-yl-2,3,4,6,6a,7,7a,8-octahydro-1H-anthra[2,3-g]quinoline-10-carboxamide.
| Compound Name | (6aR,7aS,8S,11aR)-8-(dimethylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-9,12-dioxo-4-pyrrolidin-1-yl-2,3,4,6,6a,7,7a,8-octahydro-1H-anthra[2,3-g]quinoline-10-carboxamide |
|---|---|
| PubChem CID | 121288140 |
| Molecular Formula | C28H33FN4O7 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | (6aR,7aS,8S,11aR)-8-(dimethylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-9,12-dioxo-4-pyrrolidin-1-yl-2,3,4,6,6a,7,7a,8-octahydro-1H-anthra[2,3-g]quinoline-10-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c5c(c(F)c4C[C@H]3C[C@@H]12)C(N1CCCC1)CCN5 |
| InChI | InChI=1S/C28H33FN4O7/c1-32(2)21-13-10-11-9-12-16(22(34)15(11)25(37)28(13,40)26(38)18(24(21)36)27(30)39)23(35)20-17(19(12)29)14(5-6-31-20)33-7-3-4-8-33/h11,13-14,21,31,34-35,38,40H,3-10H2,1-2H3,(H2,30,39)/t11-,13-,14?,21-,28-/m0/s1 |
| InChIKey | BOLRAVRFRKRTFL-KGUJIHIWSA-N |
| XLogP | 1.06 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|