C27H25BN5O3S — CID 71081201
CID 71081201 (PubChem CID 71081201) has the molecular formula C27H25BN5O3S and a molecular weight of 510.41 g/mol.
| Compound Name | CID 71081201 |
|---|---|
| PubChem CID | 71081201 |
| Molecular Formula | C27H25BN5O3S |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | — |
| SMILES | CO[B]NCc1ccccc1-c1ccc(C(=O)N2N=C(c3ccc(N)nc3)CC2c2ccccc2O)s1 |
| InChI | InChI=1S/C27H25BN5O3S/c1-36-28-31-16-17-6-2-3-7-19(17)24-11-12-25(37-24)27(35)33-22(20-8-4-5-9-23(20)34)14-21(32-33)18-10-13-26(29)30-15-18/h2-13,15,22,31,34H,14,16H2,1H3,(H2,29,30) |
| InChIKey | OAEKHVMSHAROGT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|