C31H28BN2O3 — CID 71083091
CID 71083091 (PubChem CID 71083091) has the molecular formula C31H28BN2O3 and a molecular weight of 487.39 g/mol.
| Compound Name | CID 71083091 |
|---|---|
| PubChem CID | 71083091 |
| Molecular Formula | C31H28BN2O3 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | — |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1cccc(C[B]Cc2cccc(Oc3ccccc3)c2)n1 |
| InChI | InChI=1S/C31H28BN2O3/c1-23-29(34-31(36-23)25-11-4-2-5-12-25)18-19-35-30-17-9-13-26(33-30)22-32-21-24-10-8-16-28(20-24)37-27-14-6-3-7-15-27/h2-17,20H,18-19,21-22H2,1H3 |
| InChIKey | SALWOFNWUZTUBF-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|