C21H15N3S — CID 71084407
3,4-diphenyl-5-pyridin-2-yl-1H-pyridazine-6-thione (PubChem CID 71084407) has the molecular formula C21H15N3S and a molecular weight of 341.44 g/mol. Its IUPAC name is 3,4-diphenyl-5-pyridin-2-yl-1H-pyridazine-6-thione.
| Compound Name | 3,4-diphenyl-5-pyridin-2-yl-1H-pyridazine-6-thione |
|---|---|
| PubChem CID | 71084407 |
| Molecular Formula | C21H15N3S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3,4-diphenyl-5-pyridin-2-yl-1H-pyridazine-6-thione |
| SMILES | S=c1[nH]nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccn1 |
| InChI | InChI=1S/C21H15N3S/c25-21-19(17-13-7-8-14-22-17)18(15-9-3-1-4-10-15)20(23-24-21)16-11-5-2-6-12-16/h1-14H,(H,24,25) |
| InChIKey | VNKJKINXUOMHRA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|