C19H18IN — CID 71084702
3-[(4S)-4-iodo-4-methylcyclohexa-1,5-dien-1-yl]-5-(3-methylphenyl)pyridine (PubChem CID 71084702) has the molecular formula C19H18IN and a molecular weight of 387.26 g/mol. Its IUPAC name is 3-[(4S)-4-iodo-4-methylcyclohexa-1,5-dien-1-yl]-5-(3-methylphenyl)pyridine.
| Compound Name | 3-[(4S)-4-iodo-4-methylcyclohexa-1,5-dien-1-yl]-5-(3-methylphenyl)pyridine |
|---|---|
| PubChem CID | 71084702 |
| Molecular Formula | C19H18IN |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 3-[(4S)-4-iodo-4-methylcyclohexa-1,5-dien-1-yl]-5-(3-methylphenyl)pyridine |
| SMILES | Cc1cccc(-c2cncc(C3=CC[C@](C)(I)C=C3)c2)c1 |
| InChI | InChI=1S/C19H18IN/c1-14-4-3-5-16(10-14)18-11-17(12-21-13-18)15-6-8-19(2,20)9-7-15/h3-8,10-13H,9H2,1-2H3/t19-/m1/s1 |
| InChIKey | SWRMPRMCDRBKIC-LJQANCHMSA-N |
| XLogP | 5.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|