C24H33BrN2O5 — CID 71092010
N-[4-[4,5-bis[(E)-2-methoxyethenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-5-bromo-2,3-dimethoxybenzamide (PubChem CID 71092010) has the molecular formula C24H33BrN2O5 and a molecular weight of 509.44 g/mol. Its IUPAC name is N-[4-[4,5-bis[(E)-2-methoxyethenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-5-bromo-2,3-dimethoxybenzamide.
| Compound Name | N-[4-[4,5-bis[(E)-2-methoxyethenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-5-bromo-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 71092010 |
| Molecular Formula | C24H33BrN2O5 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | N-[4-[4,5-bis[(E)-2-methoxyethenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-5-bromo-2,3-dimethoxybenzamide |
| SMILES | CO/C=C/C1=C(/C=C/OC)CN(CCCCNC(=O)c2cc(Br)cc(OC)c2OC)CC1 |
| InChI | InChI=1S/C24H33BrN2O5/c1-29-13-8-18-7-12-27(17-19(18)9-14-30-2)11-6-5-10-26-24(28)21-15-20(25)16-22(31-3)23(21)32-4/h8-9,13-16H,5-7,10-12,17H2,1-4H3,(H,26,28)/b13-8+,14-9+ |
| InChIKey | AXQPMBYQGCOMMN-UQNWOCKMSA-N |
| XLogP | 4.30 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|