C31H36N2O2 — CID 71102576
N-[3-[1-benzofuran-5-yl(benzyl)amino]propyl]-N-benzyl-3,3-dimethylbutanamide (PubChem CID 71102576) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is N-[3-[1-benzofuran-5-yl(benzyl)amino]propyl]-N-benzyl-3,3-dimethylbutanamide.
| Compound Name | N-[3-[1-benzofuran-5-yl(benzyl)amino]propyl]-N-benzyl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 71102576 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | N-[3-[1-benzofuran-5-yl(benzyl)amino]propyl]-N-benzyl-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N(CCCN(Cc1ccccc1)c1ccc2occc2c1)Cc1ccccc1 |
| InChI | InChI=1S/C31H36N2O2/c1-31(2,3)22-30(34)33(24-26-13-8-5-9-14-26)19-10-18-32(23-25-11-6-4-7-12-25)28-15-16-29-27(21-28)17-20-35-29/h4-9,11-17,20-21H,10,18-19,22-24H2,1-3H3 |
| InChIKey | VFGGVZNSDHFEAU-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |