C12H15NO8 — CID 71109593
4-(hydroxymethyl)-1-[hydroxy-(4-nitrophenoxy)methyl]cyclobutane-1,2,3-triol (PubChem CID 71109593) has the molecular formula C12H15NO8 and a molecular weight of 301.25 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1-[hydroxy-(4-nitrophenoxy)methyl]cyclobutane-1,2,3-triol.
| Compound Name | 4-(hydroxymethyl)-1-[hydroxy-(4-nitrophenoxy)methyl]cyclobutane-1,2,3-triol |
|---|---|
| PubChem CID | 71109593 |
| Molecular Formula | C12H15NO8 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-(hydroxymethyl)-1-[hydroxy-(4-nitrophenoxy)methyl]cyclobutane-1,2,3-triol |
| SMILES | O=[N+]([O-])c1ccc(OC(O)C2(O)C(O)C(O)C2CO)cc1 |
| InChI | InChI=1S/C12H15NO8/c14-5-8-9(15)10(16)12(8,18)11(17)21-7-3-1-6(2-4-7)13(19)20/h1-4,8-11,14-18H,5H2 |
| InChIKey | OQNIESIYZZYDFQ-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|