C17H10F4N2O2S — CID 71117327
3-(4-fluorophenyl)-2-[(2,3,6-trifluorophenyl)methylsulfanyl]imidazole-4-carboxylic acid (PubChem CID 71117327) has the molecular formula C17H10F4N2O2S and a molecular weight of 382.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-[(2,3,6-trifluorophenyl)methylsulfanyl]imidazole-4-carboxylic acid.
| Compound Name | 3-(4-fluorophenyl)-2-[(2,3,6-trifluorophenyl)methylsulfanyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 71117327 |
| Molecular Formula | C17H10F4N2O2S |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3-(4-fluorophenyl)-2-[(2,3,6-trifluorophenyl)methylsulfanyl]imidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnc(SCc2c(F)ccc(F)c2F)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H10F4N2O2S/c18-9-1-3-10(4-2-9)23-14(16(24)25)7-22-17(23)26-8-11-12(19)5-6-13(20)15(11)21/h1-7H,8H2,(H,24,25) |
| InChIKey | NUUXJUWUKIIAIG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|