C14H22F4 — CID 71119881
1-(difluoromethyl)-2-fluoro-4-(2-fluoro-4-methylcyclohexyl)cyclohexane (PubChem CID 71119881) has the molecular formula C14H22F4 and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-fluoro-4-(2-fluoro-4-methylcyclohexyl)cyclohexane.
| Compound Name | 1-(difluoromethyl)-2-fluoro-4-(2-fluoro-4-methylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 71119881 |
| Molecular Formula | C14H22F4 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-(difluoromethyl)-2-fluoro-4-(2-fluoro-4-methylcyclohexyl)cyclohexane |
| SMILES | CC1CCC(C2CCC(C(F)F)C(F)C2)C(F)C1 |
| InChI | InChI=1S/C14H22F4/c1-8-2-4-10(12(15)6-8)9-3-5-11(14(17)18)13(16)7-9/h8-14H,2-7H2,1H3 |
| InChIKey | SSJMQVVAFFAJLE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |