C12H19N2O5S- — CID 71122112
(3R,6Z)-3-(2-butoxy-2-oxoethyl)-2-oxo-1,3,5,8-tetrahydro-1,4-diazocine-4-sulfinate (PubChem CID 71122112) has the molecular formula C12H19N2O5S- and a molecular weight of 303.36 g/mol. Its IUPAC name is (3R,6Z)-3-(2-butoxy-2-oxoethyl)-2-oxo-1,3,5,8-tetrahydro-1,4-diazocine-4-sulfinate.
| Compound Name | (3R,6Z)-3-(2-butoxy-2-oxoethyl)-2-oxo-1,3,5,8-tetrahydro-1,4-diazocine-4-sulfinate |
|---|---|
| PubChem CID | 71122112 |
| Molecular Formula | C12H19N2O5S- |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (3R,6Z)-3-(2-butoxy-2-oxoethyl)-2-oxo-1,3,5,8-tetrahydro-1,4-diazocine-4-sulfinate |
| SMILES | CCCCOC(=O)C[C@@H]1C(=O)NC/C=C\CN1S(=O)[O-] |
| InChI | InChI=1S/C12H20N2O5S/c1-2-3-8-19-11(15)9-10-12(16)13-6-4-5-7-14(10)20(17)18/h4-5,10H,2-3,6-9H2,1H3,(H,13,16)(H,17,18)/p-1/b5-4-/t10-/m1/s1 |
| InChIKey | SQXRKOOSWZNKJH-UMCURTJPSA-M |
| XLogP | -0.13 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|