C14H24N2O3S — CID 89291426
butyl (3R)-4-oxo-4-(prop-2-enylamino)-3-[prop-2-enyl(sulfanyl)amino]butanoate (PubChem CID 89291426) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is butyl (3R)-4-oxo-4-(prop-2-enylamino)-3-[prop-2-enyl(sulfanyl)amino]butanoate.
| Compound Name | butyl (3R)-4-oxo-4-(prop-2-enylamino)-3-[prop-2-enyl(sulfanyl)amino]butanoate |
|---|---|
| PubChem CID | 89291426 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | butyl (3R)-4-oxo-4-(prop-2-enylamino)-3-[prop-2-enyl(sulfanyl)amino]butanoate |
| SMILES | C=CCNC(=O)[C@@H](CC(=O)OCCCC)N(S)CC=C |
| InChI | InChI=1S/C14H24N2O3S/c1-4-7-10-19-13(17)11-12(16(20)9-6-3)14(18)15-8-5-2/h5-6,12,20H,2-4,7-11H2,1H3,(H,15,18)/t12-/m1/s1 |
| InChIKey | HTQSUCRPWKFRCJ-GFCCVEGCSA-N |
| XLogP | 1.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|