C28H32N6O4S — CID 71131421
5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-N-cyclopentyl-2-methoxypyridine-3-sulfonamide (PubChem CID 71131421) has the molecular formula C28H32N6O4S and a molecular weight of 548.67 g/mol. Its IUPAC name is 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-N-cyclopentyl-2-methoxypyridine-3-sulfonamide.
| Compound Name | 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-N-cyclopentyl-2-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 71131421 |
| Molecular Formula | C28H32N6O4S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-N-cyclopentyl-2-methoxypyridine-3-sulfonamide |
| SMILES | COc1ncc(-c2ccc3nc(N)n(-c4ccc(N5CCOCC5)cc4)c3c2)cc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C28H32N6O4S/c1-37-27-26(39(35,36)32-21-4-2-3-5-21)17-20(18-30-27)19-6-11-24-25(16-19)34(28(29)31-24)23-9-7-22(8-10-23)33-12-14-38-15-13-33/h6-11,16-18,21,32H,2-5,12-15H2,1H3,(H2,29,31) |
| InChIKey | RXUOOAZIBDPWHW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|