C29H30N6O4S — CID 163885815
N-[3-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-6-methoxy-3,4-dihydropyridin-5-yl]benzenesulfonamide (PubChem CID 163885815) has the molecular formula C29H30N6O4S and a molecular weight of 558.66 g/mol. Its IUPAC name is N-[3-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-6-methoxy-3,4-dihydropyridin-5-yl]benzenesulfonamide.
| Compound Name | N-[3-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-6-methoxy-3,4-dihydropyridin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 163885815 |
| Molecular Formula | C29H30N6O4S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | N-[3-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-6-methoxy-3,4-dihydropyridin-5-yl]benzenesulfonamide |
| SMILES | COC1=C(NS(=O)(=O)c2ccccc2)CC(c2ccc3nc(N)n(-c4ccc(N5CCOCC5)cc4)c3c2)C=N1 |
| InChI | InChI=1S/C29H30N6O4S/c1-38-28-26(33-40(36,37)24-5-3-2-4-6-24)17-21(19-31-28)20-7-12-25-27(18-20)35(29(30)32-25)23-10-8-22(9-11-23)34-13-15-39-16-14-34/h2-12,18-19,21,33H,13-17H2,1H3,(H2,30,32) |
| InChIKey | PXFGXDIFAOIWBN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|