C32H34N6O6S — CID 71116570
5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-2-methoxy-N-(1-phenylethyl)pyridine-3-sulfonamide;formic acid (PubChem CID 71116570) has the molecular formula C32H34N6O6S and a molecular weight of 630.73 g/mol. Its IUPAC name is 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-2-methoxy-N-(1-phenylethyl)pyridine-3-sulfonamide;formic acid.
| Compound Name | 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-2-methoxy-N-(1-phenylethyl)pyridine-3-sulfonamide;formic acid |
|---|---|
| PubChem CID | 71116570 |
| Molecular Formula | C32H34N6O6S |
| Molecular Weight | 630.73 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-2-methoxy-N-(1-phenylethyl)pyridine-3-sulfonamide;formic acid |
| SMILES | COc1ncc(-c2ccc3nc(N)n(-c4ccc(N5CCOCC5)cc4)c3c2)cc1S(=O)(=O)NC(C)c1ccccc1.O=CO |
| InChI | InChI=1S/C31H32N6O4S.CH2O2/c1-21(22-6-4-3-5-7-22)35-42(38,39)29-19-24(20-33-30(29)40-2)23-8-13-27-28(18-23)37(31(32)34-27)26-11-9-25(10-12-26)36-14-16-41-17-15-36;2-1-3/h3-13,18-21,35H,14-17H2,1-2H3,(H2,32,34);1H,(H,2,3) |
| InChIKey | XQYDKXVRGSRQAP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|