C31H31Br — CID 71135292
1-bromo-4-[4-[4-methyl-2-[4-(4-methylphenyl)phenyl]pentan-2-yl]phenyl]benzene (PubChem CID 71135292) has the molecular formula C31H31Br and a molecular weight of 483.49 g/mol. Its IUPAC name is 1-bromo-4-[4-[4-methyl-2-[4-(4-methylphenyl)phenyl]pentan-2-yl]phenyl]benzene.
| Compound Name | 1-bromo-4-[4-[4-methyl-2-[4-(4-methylphenyl)phenyl]pentan-2-yl]phenyl]benzene |
|---|---|
| PubChem CID | 71135292 |
| Molecular Formula | C31H31Br |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 1-bromo-4-[4-[4-methyl-2-[4-(4-methylphenyl)phenyl]pentan-2-yl]phenyl]benzene |
| SMILES | Cc1ccc(-c2ccc(C(C)(CC(C)C)c3ccc(-c4ccc(Br)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H31Br/c1-22(2)21-31(4,28-15-9-25(10-16-28)24-7-5-23(3)6-8-24)29-17-11-26(12-18-29)27-13-19-30(32)20-14-27/h5-20,22H,21H2,1-4H3 |
| InChIKey | GJAZSHMEZGZFMW-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |