C8H11N3O2S — CID 7113713
5-(propyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7113713) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 5-(propyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(propyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7113713 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 5-(propyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCC/N=C/C1C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C8H11N3O2S/c1-2-3-9-4-5-6(12)10-8(14)11-7(5)13/h4-5H,2-3H2,1H3,(H2,10,11,12,13,14)/b9-4+ |
| InChIKey | JATHAKQQABTESP-RUDMXATFSA-N |
| XLogP | -0.39 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|