C15H21F2NO2S — CID 71154609
1-[[2-(difluoromethoxy)phenyl]methylsulfanyl]-2-(ethylamino)pentan-3-one (PubChem CID 71154609) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methylsulfanyl]-2-(ethylamino)pentan-3-one.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methylsulfanyl]-2-(ethylamino)pentan-3-one |
|---|---|
| PubChem CID | 71154609 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methylsulfanyl]-2-(ethylamino)pentan-3-one |
| SMILES | CCNC(CSCc1ccccc1OC(F)F)C(=O)CC |
| InChI | InChI=1S/C15H21F2NO2S/c1-3-13(19)12(18-4-2)10-21-9-11-7-5-6-8-14(11)20-15(16)17/h5-8,12,15,18H,3-4,9-10H2,1-2H3 |
| InChIKey | LMCFOVXPILAFAC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |