C8H6F4O5 — CID 7116348
(1R,2R,4R,5S)-6,6,7,7-tetrafluoro-3-oxabicyclo[3.2.0]heptane-2,4-dicarboxylic acid (PubChem CID 7116348) has the molecular formula C8H6F4O5 and a molecular weight of 258.12 g/mol. Its IUPAC name is (1R,2R,4R,5S)-6,6,7,7-tetrafluoro-3-oxabicyclo[3.2.0]heptane-2,4-dicarboxylic acid.
| Compound Name | (1R,2R,4R,5S)-6,6,7,7-tetrafluoro-3-oxabicyclo[3.2.0]heptane-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 7116348 |
| Molecular Formula | C8H6F4O5 |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | (1R,2R,4R,5S)-6,6,7,7-tetrafluoro-3-oxabicyclo[3.2.0]heptane-2,4-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@@H](C(=O)O)[C@@H]2[C@H]1C(F)(F)C2(F)F |
| InChI | InChI=1S/C8H6F4O5/c9-7(10)1-2(8(7,11)12)4(6(15)16)17-3(1)5(13)14/h1-4H,(H,13,14)(H,15,16)/t1-,2+,3-,4-/m1/s1 |
| InChIKey | ZBYYITGKQLENSW-GJPGBQJBSA-N |
| XLogP | 0.44 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|