C32H43NO — CID 71168391
N-(4-methoxyphenyl)-N-(2-methylhexan-2-yl)-4-[4-(2-methylpentan-2-yl)phenyl]aniline (PubChem CID 71168391) has the molecular formula C32H43NO and a molecular weight of 457.70 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-(2-methylhexan-2-yl)-4-[4-(2-methylpentan-2-yl)phenyl]aniline.
| Compound Name | N-(4-methoxyphenyl)-N-(2-methylhexan-2-yl)-4-[4-(2-methylpentan-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 71168391 |
| Molecular Formula | C32H43NO |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.33 |
| IUPAC Name | N-(4-methoxyphenyl)-N-(2-methylhexan-2-yl)-4-[4-(2-methylpentan-2-yl)phenyl]aniline |
| SMILES | CCCCC(C)(C)N(c1ccc(OC)cc1)c1ccc(-c2ccc(C(C)(C)CCC)cc2)cc1 |
| InChI | InChI=1S/C32H43NO/c1-8-10-24-32(5,6)33(29-19-21-30(34-7)22-20-29)28-17-13-26(14-18-28)25-11-15-27(16-12-25)31(3,4)23-9-2/h11-22H,8-10,23-24H2,1-7H3 |
| InChIKey | NSBMDMHUJMVNSS-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |