C15H19N4O2P — CID 71170634
N-(6-hydroxyquinolin-4-yl)-4-(phosphanylamino)piperidine-1-carboxamide (PubChem CID 71170634) has the molecular formula C15H19N4O2P and a molecular weight of 318.32 g/mol. Its IUPAC name is N-(6-hydroxyquinolin-4-yl)-4-(phosphanylamino)piperidine-1-carboxamide.
| Compound Name | N-(6-hydroxyquinolin-4-yl)-4-(phosphanylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71170634 |
| Molecular Formula | C15H19N4O2P |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(6-hydroxyquinolin-4-yl)-4-(phosphanylamino)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccnc2ccc(O)cc12)N1CCC(NP)CC1 |
| InChI | InChI=1S/C15H19N4O2P/c20-11-1-2-13-12(9-11)14(3-6-16-13)17-15(21)19-7-4-10(18-22)5-8-19/h1-3,6,9-10,18,20H,4-5,7-8,22H2,(H,16,17,21) |
| InChIKey | PCQFJKQLIHMOCQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|