C21H36O2 — CID 71174916
4-(3,3-dimethyl-2-propan-2-ylbutyl)-1-methoxy-2-(4-methoxybutyl)benzene (PubChem CID 71174916) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 4-(3,3-dimethyl-2-propan-2-ylbutyl)-1-methoxy-2-(4-methoxybutyl)benzene.
| Compound Name | 4-(3,3-dimethyl-2-propan-2-ylbutyl)-1-methoxy-2-(4-methoxybutyl)benzene |
|---|---|
| PubChem CID | 71174916 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 4-(3,3-dimethyl-2-propan-2-ylbutyl)-1-methoxy-2-(4-methoxybutyl)benzene |
| SMILES | COCCCCc1cc(CC(C(C)C)C(C)(C)C)ccc1OC |
| InChI | InChI=1S/C21H36O2/c1-16(2)19(21(3,4)5)15-17-11-12-20(23-7)18(14-17)10-8-9-13-22-6/h11-12,14,16,19H,8-10,13,15H2,1-7H3 |
| InChIKey | ASVXEVOWDGNUDG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|