C17H27ClO3 — CID 59099854
4-[(2R)-2-(chloromethyl)-3-methylbutyl]-1-methoxy-2-(2-methoxyethoxymethyl)benzene (PubChem CID 59099854) has the molecular formula C17H27ClO3 and a molecular weight of 314.85 g/mol. Its IUPAC name is 4-[(2R)-2-(chloromethyl)-3-methylbutyl]-1-methoxy-2-(2-methoxyethoxymethyl)benzene.
| Compound Name | 4-[(2R)-2-(chloromethyl)-3-methylbutyl]-1-methoxy-2-(2-methoxyethoxymethyl)benzene |
|---|---|
| PubChem CID | 59099854 |
| Molecular Formula | C17H27ClO3 |
| Molecular Weight | 314.85 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-[(2R)-2-(chloromethyl)-3-methylbutyl]-1-methoxy-2-(2-methoxyethoxymethyl)benzene |
| SMILES | COCCOCc1cc(C[C@@H](CCl)C(C)C)ccc1OC |
| InChI | InChI=1S/C17H27ClO3/c1-13(2)15(11-18)9-14-5-6-17(20-4)16(10-14)12-21-8-7-19-3/h5-6,10,13,15H,7-9,11-12H2,1-4H3/t15-/m0/s1 |
| InChIKey | XYVVTFYRWVRGEY-HNNXBMFYSA-N |
| XLogP | 3.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.85 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|