C27H45NO4 — CID 91532213
(2S,7R)-7-[[4-methoxy-3-(2-methoxyethoxymethyl)phenyl]methyl]-N,N,8-trimethyl-2-propan-2-ylnon-4-enamide (PubChem CID 91532213) has the molecular formula C27H45NO4 and a molecular weight of 447.66 g/mol. Its IUPAC name is (2S,7R)-7-[[4-methoxy-3-(2-methoxyethoxymethyl)phenyl]methyl]-N,N,8-trimethyl-2-propan-2-ylnon-4-enamide.
| Compound Name | (2S,7R)-7-[[4-methoxy-3-(2-methoxyethoxymethyl)phenyl]methyl]-N,N,8-trimethyl-2-propan-2-ylnon-4-enamide |
|---|---|
| PubChem CID | 91532213 |
| Molecular Formula | C27H45NO4 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | (2S,7R)-7-[[4-methoxy-3-(2-methoxyethoxymethyl)phenyl]methyl]-N,N,8-trimethyl-2-propan-2-ylnon-4-enamide |
| SMILES | COCCOCc1cc(C[C@@H](CC=CC[C@H](C(=O)N(C)C)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C27H45NO4/c1-20(2)23(11-9-10-12-25(21(3)4)27(29)28(5)6)17-22-13-14-26(31-8)24(18-22)19-32-16-15-30-7/h9-10,13-14,18,20-21,23,25H,11-12,15-17,19H2,1-8H3/t23-,25+/m1/s1 |
| InChIKey | ZAAZZJOGIVDYAP-NOZRDPDXSA-N |
| XLogP | 5.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|