C28H45NO4 — CID 90734071
8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-N,N-dimethyl-2,7-di(propan-2-yl)nona-4,8-dienamide (PubChem CID 90734071) has the molecular formula C28H45NO4 and a molecular weight of 459.67 g/mol. Its IUPAC name is 8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-N,N-dimethyl-2,7-di(propan-2-yl)nona-4,8-dienamide.
| Compound Name | 8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-N,N-dimethyl-2,7-di(propan-2-yl)nona-4,8-dienamide |
|---|---|
| PubChem CID | 90734071 |
| Molecular Formula | C28H45NO4 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | 8-[4-methoxy-3-(3-methoxypropoxy)phenyl]-N,N-dimethyl-2,7-di(propan-2-yl)nona-4,8-dienamide |
| SMILES | C=C(c1ccc(OC)c(OCCCOC)c1)C(CC=CCC(C(=O)N(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C28H45NO4/c1-20(2)24(13-10-11-14-25(21(3)4)28(30)29(6)7)22(5)23-15-16-26(32-9)27(19-23)33-18-12-17-31-8/h10-11,15-16,19-21,24-25H,5,12-14,17-18H2,1-4,6-9H3 |
| InChIKey | URPKQRPGXHAKAE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|