C29H43NO5 — CID 163815531
(E,2S,7S)-7-[4-ethenoxy-3-(3-ethenoxypropoxy)benzoyl]-N,N,8-trimethyl-2-propan-2-ylnon-4-enamide (PubChem CID 163815531) has the molecular formula C29H43NO5 and a molecular weight of 485.67 g/mol. Its IUPAC name is (E,2S,7S)-7-[4-ethenoxy-3-(3-ethenoxypropoxy)benzoyl]-N,N,8-trimethyl-2-propan-2-ylnon-4-enamide.
| Compound Name | (E,2S,7S)-7-[4-ethenoxy-3-(3-ethenoxypropoxy)benzoyl]-N,N,8-trimethyl-2-propan-2-ylnon-4-enamide |
|---|---|
| PubChem CID | 163815531 |
| Molecular Formula | C29H43NO5 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | (E,2S,7S)-7-[4-ethenoxy-3-(3-ethenoxypropoxy)benzoyl]-N,N,8-trimethyl-2-propan-2-ylnon-4-enamide |
| SMILES | C=COCCCOc1cc(C(=O)[C@@H](C/C=C/C[C@H](C(=O)N(C)C)C(C)C)C(C)C)ccc1OC=C |
| InChI | InChI=1S/C29H43NO5/c1-9-33-18-13-19-35-27-20-23(16-17-26(27)34-10-2)28(31)24(21(3)4)14-11-12-15-25(22(5)6)29(32)30(7)8/h9-12,16-17,20-22,24-25H,1-2,13-15,18-19H2,3-8H3/b12-11+/t24-,25-/m0/s1 |
| InChIKey | NQZSOAMYMJRYIP-VPFRDICFSA-N |
| XLogP | 6.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|