C20H29BrO4 — CID 67410609
(2S)-6-bromo-1-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-propan-2-ylhex-4-en-1-one (PubChem CID 67410609) has the molecular formula C20H29BrO4 and a molecular weight of 413.35 g/mol. Its IUPAC name is (2S)-6-bromo-1-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-propan-2-ylhex-4-en-1-one.
| Compound Name | (2S)-6-bromo-1-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-propan-2-ylhex-4-en-1-one |
|---|---|
| PubChem CID | 67410609 |
| Molecular Formula | C20H29BrO4 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (2S)-6-bromo-1-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2-propan-2-ylhex-4-en-1-one |
| SMILES | COCCCOc1cc(C(=O)[C@@H](CC=CCBr)C(C)C)ccc1OC |
| InChI | InChI=1S/C20H29BrO4/c1-15(2)17(8-5-6-11-21)20(22)16-9-10-18(24-4)19(14-16)25-13-7-12-23-3/h5-6,9-10,14-15,17H,7-8,11-13H2,1-4H3/t17-/m0/s1 |
| InChIKey | ATCFDKABYJEESK-KRWDZBQOSA-N |
| XLogP | 4.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|