C30H48N2O7 — CID 87599744
(E)-7-[(Z)-C-[4-methoxy-3-(3-methoxypropoxy)phenyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbonimidoyl]-8-methyl-2-propan-2-ylnon-4-enoic acid (PubChem CID 87599744) has the molecular formula C30H48N2O7 and a molecular weight of 548.72 g/mol. Its IUPAC name is (E)-7-[(Z)-C-[4-methoxy-3-(3-methoxypropoxy)phenyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbonimidoyl]-8-methyl-2-propan-2-ylnon-4-enoic acid.
| Compound Name | (E)-7-[(Z)-C-[4-methoxy-3-(3-methoxypropoxy)phenyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbonimidoyl]-8-methyl-2-propan-2-ylnon-4-enoic acid |
|---|---|
| PubChem CID | 87599744 |
| Molecular Formula | C30H48N2O7 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | (E)-7-[(Z)-C-[4-methoxy-3-(3-methoxypropoxy)phenyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbonimidoyl]-8-methyl-2-propan-2-ylnon-4-enoic acid |
| SMILES | COCCCOc1cc(/C(=N\NC(=O)OC(C)(C)C)C(C/C=C/CC(C(=O)O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C30H48N2O7/c1-20(2)23(13-10-11-14-24(21(3)4)28(33)34)27(31-32-29(35)39-30(5,6)7)22-15-16-25(37-9)26(19-22)38-18-12-17-36-8/h10-11,15-16,19-21,23-24H,12-14,17-18H2,1-9H3,(H,32,35)(H,33,34)/b11-10+,31-27+ |
| InChIKey | GAGYOHRQZPLSDQ-ZHPXUUEWSA-N |
| XLogP | 6.30 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|