C30H51NO3 — CID 143057538
(4R)-4-[2-(aminomethyl)prop-2-enyl]-7-[[4-methoxy-3-(4-methoxybutyl)phenyl]methyl]-8-methyl-2-propan-2-ylnonanal (PubChem CID 143057538) has the molecular formula C30H51NO3 and a molecular weight of 473.74 g/mol. Its IUPAC name is (4R)-4-[2-(aminomethyl)prop-2-enyl]-7-[[4-methoxy-3-(4-methoxybutyl)phenyl]methyl]-8-methyl-2-propan-2-ylnonanal.
| Compound Name | (4R)-4-[2-(aminomethyl)prop-2-enyl]-7-[[4-methoxy-3-(4-methoxybutyl)phenyl]methyl]-8-methyl-2-propan-2-ylnonanal |
|---|---|
| PubChem CID | 143057538 |
| Molecular Formula | C30H51NO3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.39 |
| IUPAC Name | (4R)-4-[2-(aminomethyl)prop-2-enyl]-7-[[4-methoxy-3-(4-methoxybutyl)phenyl]methyl]-8-methyl-2-propan-2-ylnonanal |
| SMILES | C=C(CN)CC(CCC(Cc1ccc(OC)c(CCCCOC)c1)C(C)C)CC(C=O)C(C)C |
| InChI | InChI=1S/C30H51NO3/c1-22(2)27(13-11-25(16-24(5)20-31)19-29(21-32)23(3)4)17-26-12-14-30(34-7)28(18-26)10-8-9-15-33-6/h12,14,18,21-23,25,27,29H,5,8-11,13,15-17,19-20,31H2,1-4,6-7H3 |
| InChIKey | AAKKJXQBLPZZSS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|