C20H26N2O2 — CID 7117556
2-(2-methyl-1H-indol-3-yl)-2-oxo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide (PubChem CID 7117556) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-2-oxo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-2-oxo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7117556 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-2-oxo-N-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)N[C@H]1C[C@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C20H26N2O2/c1-12-9-14(11-20(3,4)10-12)22-19(24)18(23)17-13(2)21-16-8-6-5-7-15(16)17/h5-8,12,14,21H,9-11H2,1-4H3,(H,22,24)/t12-,14-/m0/s1 |
| InChIKey | USEFRRDRYZBXLP-JSGCOSHPSA-N |
| XLogP | 3.99 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|