C20H32N2O6S — CID 71188092
2-[(2-amino-2-oxoethyl)-sulfinoamino]-4-(8-ethoxy-7,7-dimethyl-8-oxooctyl)-1-hydroxybenzene (PubChem CID 71188092) has the molecular formula C20H32N2O6S and a molecular weight of 428.55 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-sulfinoamino]-4-(8-ethoxy-7,7-dimethyl-8-oxooctyl)-1-hydroxybenzene.
| Compound Name | 2-[(2-amino-2-oxoethyl)-sulfinoamino]-4-(8-ethoxy-7,7-dimethyl-8-oxooctyl)-1-hydroxybenzene |
|---|---|
| PubChem CID | 71188092 |
| Molecular Formula | C20H32N2O6S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-sulfinoamino]-4-(8-ethoxy-7,7-dimethyl-8-oxooctyl)-1-hydroxybenzene |
| SMILES | CCOC(=O)C(C)(C)CCCCCCc1ccc(O)c(N(CC(N)=O)S(=O)O)c1 |
| InChI | InChI=1S/C20H32N2O6S/c1-4-28-19(25)20(2,3)12-8-6-5-7-9-15-10-11-17(23)16(13-15)22(29(26)27)14-18(21)24/h10-11,13,23H,4-9,12,14H2,1-3H3,(H2,21,24)(H,26,27) |
| InChIKey | KRHGDJVDZMPHJZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|