C16H28O — CID 71188550
8-cyclopropylidene-4,4,6,6-tetramethylnonan-2-one (PubChem CID 71188550) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 8-cyclopropylidene-4,4,6,6-tetramethylnonan-2-one.
| Compound Name | 8-cyclopropylidene-4,4,6,6-tetramethylnonan-2-one |
|---|---|
| PubChem CID | 71188550 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 8-cyclopropylidene-4,4,6,6-tetramethylnonan-2-one |
| SMILES | CC(=O)CC(C)(C)CC(C)(C)CC(C)=C1CC1 |
| InChI | InChI=1S/C16H28O/c1-12(14-7-8-14)9-15(3,4)11-16(5,6)10-13(2)17/h7-11H2,1-6H3 |
| InChIKey | DOBJKKFYWPHDDD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|