C15H25NO2 — CID 71195850
1-(2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-1-yl)propan-1-one (PubChem CID 71195850) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-1-yl)propan-1-one.
| Compound Name | 1-(2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 71195850 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-(2-tert-butyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-1-yl)propan-1-one |
| SMILES | CCC(=O)C1C2C3CCC(O3)C2CN1C(C)(C)C |
| InChI | InChI=1S/C15H25NO2/c1-5-10(17)14-13-9(8-16(14)15(2,3)4)11-6-7-12(13)18-11/h9,11-14H,5-8H2,1-4H3 |
| InChIKey | BSAIORDKGYIYFV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |