C12H13O3P — CID 71196694
4-hydroxy-2-[(3-phosphanyloxyphenyl)methyl]cyclopent-2-en-1-one (PubChem CID 71196694) has the molecular formula C12H13O3P and a molecular weight of 236.21 g/mol. Its IUPAC name is 4-hydroxy-2-[(3-phosphanyloxyphenyl)methyl]cyclopent-2-en-1-one.
| Compound Name | 4-hydroxy-2-[(3-phosphanyloxyphenyl)methyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 71196694 |
| Molecular Formula | C12H13O3P |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 4-hydroxy-2-[(3-phosphanyloxyphenyl)methyl]cyclopent-2-en-1-one |
| SMILES | O=C1CC(O)C=C1Cc1cccc(OP)c1 |
| InChI | InChI=1S/C12H13O3P/c13-10-6-9(12(14)7-10)4-8-2-1-3-11(5-8)15-16/h1-3,5-6,10,13H,4,7,16H2 |
| InChIKey | XUHCJAZTROEHPR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|